You can:
Name | D-2-aminoadipic acid |
---|---|
Molecular formula | C6H11NO4 |
IUPAC name | (2R)-2-aminohexanedioic acid |
Molecular weight | 161.157 |
Hydrogen bond acceptor | 5 |
Hydrogen bond donor | 3 |
XlogP | -3.1 |
Synonyms | (R)-2-Aminohexanedioic acid AC1Q4UAX CA-639 D-2-Aminoadipic acid, 98% Hexanedioic acid, 2-amino-, (-)- and (+)- [ Show all ] |
Inchi Key | OYIFNHCXNCRBQI-SCSAIBSYSA-N |
Inchi ID | InChI=1S/C6H11NO4/c7-4(6(10)11)2-1-3-5(8)9/h4H,1-3,7H2,(H,8,9)(H,10,11)/t4-/m1/s1 |
PubChem CID | 165627 |
ChEMBL | CHEMBL1169505 |
IUPHAR | N/A |
BindingDB | 85356 |
DrugBank | N/A |
Structure | |
Lipinski's druglikeness | This ligand satisfies Lipinski's rule of five. |
You can:
GLASS ID | Name | UniProt | Gene | Species | Length |
---|---|---|---|---|---|
253265 | Metabotropic glutamate receptor 1 | P23385 | Grm1 | Rattus norvegicus (Rat) | 1199 |
253271 | Metabotropic glutamate receptor 1 | Q13255 | GRM1 | Homo sapiens (Human) | 1194 |
253267 | Metabotropic glutamate receptor 2 | P31421 | Grm2 | Rattus norvegicus (Rat) | 872 |
253269 | Metabotropic glutamate receptor 2 | Q14416 | GRM2 | Homo sapiens (Human) | 872 |
542703 | Metabotropic glutamate receptor 4 | P31423 | Grm4 | Rattus norvegicus (Rat) | 912 |
556443 | Metabotropic glutamate receptor 5 | P31424 | Grm5 | Rattus norvegicus (Rat) | 1203 |
253264 | Metabotropic glutamate receptor 6 | P35349 | Grm6 | Rattus norvegicus (Rat) | 871 |
253266 | Metabotropic glutamate receptor 6 | O15303 | GRM6 | Homo sapiens (Human) | 877 |
253270 | Thyrotropin receptor | P16473 | TSHR | Homo sapiens (Human) | 764 |
zhanglabzhanggroup.org | (734) 647-1549 | 100 Washtenaw Avenue, Ann Arbor, MI 48109-2218