You can:
Name | CHEMBL296395 |
---|---|
Molecular formula | C22H24N2O4 |
IUPAC name | 2-[4-[(5-methoxy-3,4-dihydro-2H-chromen-3-yl)amino]butyl]isoindole-1,3-dione |
Molecular weight | 380.444 |
Hydrogen bond acceptor | 5 |
Hydrogen bond donor | 1 |
XlogP | 2.9 |
Synonyms | 3-[N-(4-PHTHALIMIDOBUTYL)AMINO]-5-METHOXYCHROMAN CHEMBL1183429 2-[4-(5-Methoxy-chroman-3-ylamino)-butyl]-isoindole-1,3-dione; compound with oxalic acid LS-84561 2-[4-[[(5-Methoxy-3,4-dihydro-2H-1-benzopyran)-3-yl]amino]butyl]-1H-isoindole-1,3(2H)-dione [ Show all ] |
Inchi Key | FVFQQWRAUZNCPU-UHFFFAOYSA-N |
Inchi ID | InChI=1S/C22H24N2O4/c1-27-19-9-6-10-20-18(19)13-15(14-28-20)23-11-4-5-12-24-21(25)16-7-2-3-8-17(16)22(24)26/h2-3,6-10,15,23H,4-5,11-14H2,1H3 |
PubChem CID | 10429859 |
ChEMBL | N/A |
IUPHAR | N/A |
BindingDB | 50036867 |
DrugBank | N/A |
Structure | |
Lipinski's druglikeness | This ligand satisfies Lipinski's rule of five. |
You can:
GLASS ID | Name | UniProt | Gene | Species | Length |
---|---|---|---|---|---|
88086 | 5-hydroxytryptamine receptor 1A | P19327 | Htr1a | Rattus norvegicus (Rat) | 422 |
88083 | 5-hydroxytryptamine receptor 1B | P28564 | Htr1b | Rattus norvegicus (Rat) | 386 |
88081 | 5-hydroxytryptamine receptor 2A | Q75Z89 | HTR2A | Bos taurus (Bovine) | 470 |
88084 | Alpha-1A adrenergic receptor | P18130 | ADRA1A | Bos taurus (Bovine) | 466 |
88082 | Alpha-2A adrenergic receptor | Q28838 | ADRA2A | Bos taurus (Bovine) | 452 |
88080 | D(1A) dopamine receptor | Q95136 | DRD1 | Bos taurus (Bovine) | 446 |
88085 | D(2) dopamine receptor | P20288 | DRD2 | Bos taurus (Bovine) | 444 |
zhanglabzhanggroup.org | (734) 647-1549 | 100 Washtenaw Avenue, Ann Arbor, MI 48109-2218