You can:
Name | CHEMBL50841 |
---|---|
Molecular formula | C24H34N2O4 |
IUPAC name | 8-[2-[(5-methoxy-3,4-dihydro-2H-chromen-3-yl)-propylamino]ethyl]-8-azaspiro[4.5]decane-7,9-dione |
Molecular weight | 414.546 |
Hydrogen bond acceptor | 5 |
Hydrogen bond donor | 0 |
XlogP | 3.9 |
Synonyms | 8-{2-[(5-Methoxy-chroman-3-yl)-propyl-amino]-ethyl}-8-aza-spiro[4.5]decane-7,9-dione; compound with oxalic acid CHEMBL28339 BDBM50036871 |
Inchi Key | LJXVXMDOHJFURJ-UHFFFAOYSA-N |
Inchi ID | InChI=1S/C24H34N2O4/c1-3-11-25(18-14-19-20(29-2)7-6-8-21(19)30-17-18)12-13-26-22(27)15-24(16-23(26)28)9-4-5-10-24/h6-8,18H,3-5,9-17H2,1-2H3 |
PubChem CID | 10047428 |
ChEMBL | CHEMBL28339 |
IUPHAR | N/A |
BindingDB | 50036871 |
DrugBank | N/A |
Structure | |
Lipinski's druglikeness | This ligand satisfies Lipinski's rule of five. |
You can:
GLASS ID | Name | UniProt | Gene | Species | Length |
---|---|---|---|---|---|
189339 | 5-hydroxytryptamine receptor 1A | P19327 | Htr1a | Rattus norvegicus (Rat) | 422 |
189341 | 5-hydroxytryptamine receptor 1B | P28564 | Htr1b | Rattus norvegicus (Rat) | 386 |
189345 | 5-hydroxytryptamine receptor 2A | Q75Z89 | HTR2A | Bos taurus (Bovine) | 470 |
189340 | Alpha-1A adrenergic receptor | P18130 | ADRA1A | Bos taurus (Bovine) | 466 |
189342 | Alpha-2A adrenergic receptor | Q28838 | ADRA2A | Bos taurus (Bovine) | 452 |
189343 | D(1A) dopamine receptor | Q95136 | DRD1 | Bos taurus (Bovine) | 446 |
189344 | D(2) dopamine receptor | P20288 | DRD2 | Bos taurus (Bovine) | 444 |
zhanglabzhanggroup.org | (734) 647-1549 | 100 Washtenaw Avenue, Ann Arbor, MI 48109-2218