You can:
Name | SKF 83822 |
---|---|
Molecular formula | C20H22ClNO2 |
IUPAC name | 9-chloro-5-(3-methylphenyl)-3-prop-2-enyl-1,2,4,5-tetrahydro-3-benzazepine-7,8-diol |
Molecular weight | 343.851 |
Hydrogen bond acceptor | 3 |
Hydrogen bond donor | 2 |
XlogP | 4.2 |
Synonyms | SK and F 83822 1H-3-Benzazepine-7,8-diol, 6-chloro-2,3,4,5-tetrahydro-1-(3-methylphenyl)-3-(2-propenyl)- BRD-A14969012-001-01-1 DTXSID3043819 SKF-83822 [ Show all ] |
Inchi Key | HLNOXCRCYMOMLA-UHFFFAOYSA-N |
Inchi ID | InChI=1S/C20H22ClNO2/c1-3-8-22-9-7-15-16(11-18(23)20(24)19(15)21)17(12-22)14-6-4-5-13(2)10-14/h3-6,10-11,17,23-24H,1,7-9,12H2,2H3 |
PubChem CID | 10020353 |
ChEMBL | N/A |
IUPHAR | N/A |
BindingDB | 86277 |
DrugBank | N/A |
Structure | |
Lipinski's druglikeness | This ligand satisfies Lipinski's rule of five. |
You can:
GLASS ID | Name | UniProt | Gene | Species | Length |
---|---|---|---|---|---|
555932 | 5-hydroxytryptamine receptor 2A | P14842 | Htr2a | Rattus norvegicus (Rat) | 471 |
118077 | Alpha-2C adrenergic receptor | P22086 | Adra2c | Rattus norvegicus (Rat) | 458 |
118076 | D(1A) dopamine receptor | P18901 | Drd1 | Rattus norvegicus (Rat) | 446 |
118075 | D(1B) dopamine receptor | P21918 | DRD5 | Homo sapiens (Human) | 477 |
555933 | D(2) dopamine receptor | P61169 | Drd2 | Rattus norvegicus (Rat) | 444 |
555931 | D(3) dopamine receptor | P35462 | DRD3 | Homo sapiens (Human) | 400 |
zhanglabzhanggroup.org | (734) 647-1549 | 100 Washtenaw Avenue, Ann Arbor, MI 48109-2218